C18H25N3O2 — CID 146081380
2-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)cycloheptane-1-carboxamide (PubChem CID 146081380) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)cycloheptane-1-carboxamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 146081380 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)cycloheptane-1-carboxamide |
| SMILES | NC(=O)C1CCCCCC1NC(=O)NC1CCc2ccccc21 |
| InChI | InChI=1S/C18H25N3O2/c19-17(22)14-8-2-1-3-9-15(14)20-18(23)21-16-11-10-12-6-4-5-7-13(12)16/h4-7,14-16H,1-3,8-11H2,(H2,19,22)(H2,20,21,23) |
| InChIKey | OKPAQZYWXVQZND-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |