C12H22ClNO3 — CID 146082025
tert-butyl 3-(2-chloropropanoylamino)-2,2-dimethylpropanoate (PubChem CID 146082025) has the molecular formula C12H22ClNO3 and a molecular weight of 263.76 g/mol. Its IUPAC name is tert-butyl 3-(2-chloropropanoylamino)-2,2-dimethylpropanoate.
| Compound Name | tert-butyl 3-(2-chloropropanoylamino)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146082025 |
| Molecular Formula | C12H22ClNO3 |
| Molecular Weight | 263.76 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | tert-butyl 3-(2-chloropropanoylamino)-2,2-dimethylpropanoate |
| SMILES | CC(Cl)C(=O)NCC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22ClNO3/c1-8(13)9(15)14-7-12(5,6)10(16)17-11(2,3)4/h8H,7H2,1-6H3,(H,14,15) |
| InChIKey | KKBDROFKHIAWNY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.76 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|