C18H20N6OS2 — CID 146082601
N-(3-ethoxypropyl)-4,6-bis(pyridin-2-ylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 146082601) has the molecular formula C18H20N6OS2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4,6-bis(pyridin-2-ylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | N-(3-ethoxypropyl)-4,6-bis(pyridin-2-ylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 146082601 |
| Molecular Formula | C18H20N6OS2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(3-ethoxypropyl)-4,6-bis(pyridin-2-ylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCOCCCNc1nc(Sc2ccccn2)nc(Sc2ccccn2)n1 |
| InChI | InChI=1S/C18H20N6OS2/c1-2-25-13-7-12-21-16-22-17(26-14-8-3-5-10-19-14)24-18(23-16)27-15-9-4-6-11-20-15/h3-6,8-11H,2,7,12-13H2,1H3,(H,21,22,23,24) |
| InChIKey | WGOZXCFWQOYTNR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|