C13H18N6S — CID 46786245
2-N-butyl-6-(pyridin-2-ylsulfanylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 46786245) has the molecular formula C13H18N6S and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-N-butyl-6-(pyridin-2-ylsulfanylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-butyl-6-(pyridin-2-ylsulfanylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46786245 |
| Molecular Formula | C13H18N6S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-N-butyl-6-(pyridin-2-ylsulfanylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc(CSc2ccccn2)n1 |
| InChI | InChI=1S/C13H18N6S/c1-2-3-7-16-13-18-10(17-12(14)19-13)9-20-11-6-4-5-8-15-11/h4-6,8H,2-3,7,9H2,1H3,(H3,14,16,17,18,19) |
| InChIKey | UGIVETSIMYDMEB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|