C11H21N5O — CID 112746452
5-[(4-amino-6-propyl-1,3,5-triazin-2-yl)amino]pentan-2-ol (PubChem CID 112746452) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-[(4-amino-6-propyl-1,3,5-triazin-2-yl)amino]pentan-2-ol.
| Compound Name | 5-[(4-amino-6-propyl-1,3,5-triazin-2-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 112746452 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 5-[(4-amino-6-propyl-1,3,5-triazin-2-yl)amino]pentan-2-ol |
| SMILES | CCCc1nc(N)nc(NCCCC(C)O)n1 |
| InChI | InChI=1S/C11H21N5O/c1-3-5-9-14-10(12)16-11(15-9)13-7-4-6-8(2)17/h8,17H,3-7H2,1-2H3,(H3,12,13,14,15,16) |
| InChIKey | GOYSHQPXDZHGNY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|