C10H9ClF2N2O — CID 146083394
trans-(1S,2S)-N-(6-chloro-3-pyridinyl)-2-(difluoromethyl)cyclopropane-1-carboxamide (PubChem CID 146083394) has the molecular formula C10H9ClF2N2O and a molecular weight of 246.64 g/mol. Its IUPAC name is trans-(1S,2S)-N-(6-chloro-3-pyridinyl)-2-(difluoromethyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-(6-chloro-3-pyridinyl)-2-(difluoromethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 146083394 |
| Molecular Formula | C10H9ClF2N2O |
| Molecular Weight | 246.64 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | trans-(1S,2S)-N-(6-chloro-3-pyridinyl)-2-(difluoromethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)[C@H]1C[C@@H]1C(F)F |
| InChI | InChI=1S/C10H9ClF2N2O/c11-8-2-1-5(4-14-8)15-10(16)7-3-6(7)9(12)13/h1-2,4,6-7,9H,3H2,(H,15,16)/t6-,7-/m0/s1 |
| InChIKey | WRTZVRVJYFKBDH-BQBZGAKWSA-N |
| XLogP | 2.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.64 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|