C15H21F2N3O2 — CID 146086928
N-(2-acetamidoethyl)-2-[2-(3,4-difluorophenyl)propan-2-ylamino]acetamide (PubChem CID 146086928) has the molecular formula C15H21F2N3O2 and a molecular weight of 313.35 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[2-(3,4-difluorophenyl)propan-2-ylamino]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[2-(3,4-difluorophenyl)propan-2-ylamino]acetamide |
|---|---|
| PubChem CID | 146086928 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[2-(3,4-difluorophenyl)propan-2-ylamino]acetamide |
| SMILES | CC(=O)NCCNC(=O)CNC(C)(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H21F2N3O2/c1-10(21)18-6-7-19-14(22)9-20-15(2,3)11-4-5-12(16)13(17)8-11/h4-5,8,20H,6-7,9H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | ZGLMHHAIAVAYTJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|