C16H21N3O3 — CID 146087666
1-(oxepan-4-yl)-3-[(2-oxo-1,3-dihydroindol-5-yl)methyl]urea (PubChem CID 146087666) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-(oxepan-4-yl)-3-[(2-oxo-1,3-dihydroindol-5-yl)methyl]urea.
| Compound Name | 1-(oxepan-4-yl)-3-[(2-oxo-1,3-dihydroindol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 146087666 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-(oxepan-4-yl)-3-[(2-oxo-1,3-dihydroindol-5-yl)methyl]urea |
| SMILES | O=C1Cc2cc(CNC(=O)NC3CCCOCC3)ccc2N1 |
| InChI | InChI=1S/C16H21N3O3/c20-15-9-12-8-11(3-4-14(12)19-15)10-17-16(21)18-13-2-1-6-22-7-5-13/h3-4,8,13H,1-2,5-7,9-10H2,(H,19,20)(H2,17,18,21) |
| InChIKey | XDECCGCHCUIKOA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |