C14H16N6O4 — CID 146089635
1-methyl-3-[1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-yl]urea (PubChem CID 146089635) has the molecular formula C14H16N6O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is 1-methyl-3-[1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-yl]urea.
| Compound Name | 1-methyl-3-[1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 146089635 |
| Molecular Formula | C14H16N6O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-methyl-3-[1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-yl]urea |
| SMILES | CNC(=O)NC1CCN(c2nc(-c3ccc([N+](=O)[O-])cc3)no2)C1 |
| InChI | InChI=1S/C14H16N6O4/c1-15-13(21)16-10-6-7-19(8-10)14-17-12(18-24-14)9-2-4-11(5-3-9)20(22)23/h2-5,10H,6-8H2,1H3,(H2,15,16,21) |
| InChIKey | HBLQLONJTJBRSF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|