C16H17N5O4 — CID 86805168
N-cyclopropyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-2-carboxamide (PubChem CID 86805168) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is N-cyclopropyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 86805168 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-cyclopropyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CC1)C1CCCN1c1nc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C16H17N5O4/c22-15(17-11-5-6-11)13-2-1-9-20(13)16-18-14(19-25-16)10-3-7-12(8-4-10)21(23)24/h3-4,7-8,11,13H,1-2,5-6,9H2,(H,17,22) |
| InChIKey | DCOULFMYEURGLF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|