C21H23FN4O3 — CID 146091467
4-[[2-[4-(4-ethylphenyl)piperazin-1-yl]-2-oxoacetyl]amino]-2-fluorobenzamide (PubChem CID 146091467) has the molecular formula C21H23FN4O3 and a molecular weight of 398.44 g/mol. Its IUPAC name is 4-[[2-[4-(4-ethylphenyl)piperazin-1-yl]-2-oxoacetyl]amino]-2-fluorobenzamide.
| Compound Name | 4-[[2-[4-(4-ethylphenyl)piperazin-1-yl]-2-oxoacetyl]amino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 146091467 |
| Molecular Formula | C21H23FN4O3 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[[2-[4-(4-ethylphenyl)piperazin-1-yl]-2-oxoacetyl]amino]-2-fluorobenzamide |
| SMILES | CCc1ccc(N2CCN(C(=O)C(=O)Nc3ccc(C(N)=O)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H23FN4O3/c1-2-14-3-6-16(7-4-14)25-9-11-26(12-10-25)21(29)20(28)24-15-5-8-17(19(23)27)18(22)13-15/h3-8,13H,2,9-12H2,1H3,(H2,23,27)(H,24,28) |
| InChIKey | MXIQSPFNZFKWSN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|