C19H20ClN3OS — CID 146092309
N-[3-(3-chlorophenyl)cyclohexyl]-2-imidazo[2,1-b][1,3]thiazol-3-ylacetamide (PubChem CID 146092309) has the molecular formula C19H20ClN3OS and a molecular weight of 373.91 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)cyclohexyl]-2-imidazo[2,1-b][1,3]thiazol-3-ylacetamide.
| Compound Name | N-[3-(3-chlorophenyl)cyclohexyl]-2-imidazo[2,1-b][1,3]thiazol-3-ylacetamide |
|---|---|
| PubChem CID | 146092309 |
| Molecular Formula | C19H20ClN3OS |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[3-(3-chlorophenyl)cyclohexyl]-2-imidazo[2,1-b][1,3]thiazol-3-ylacetamide |
| SMILES | O=C(Cc1csc2nccn12)NC1CCCC(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H20ClN3OS/c20-15-5-1-3-13(9-15)14-4-2-6-16(10-14)22-18(24)11-17-12-25-19-21-7-8-23(17)19/h1,3,5,7-9,12,14,16H,2,4,6,10-11H2,(H,22,24) |
| InChIKey | WEVNYMPUSDBJEO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |