C18H18F3N3O2S — CID 146092496
1-[(2R,4R)-2-pyridin-2-yloxan-4-yl]-3-[4-(trifluoromethoxy)phenyl]thiourea (PubChem CID 146092496) has the molecular formula C18H18F3N3O2S and a molecular weight of 397.42 g/mol. Its IUPAC name is 1-[(2R,4R)-2-pyridin-2-yloxan-4-yl]-3-[4-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-[(2R,4R)-2-pyridin-2-yloxan-4-yl]-3-[4-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 146092496 |
| Molecular Formula | C18H18F3N3O2S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-[(2R,4R)-2-pyridin-2-yloxan-4-yl]-3-[4-(trifluoromethoxy)phenyl]thiourea |
| SMILES | FC(F)(F)Oc1ccc(NC(=S)N[C@@H]2CCO[C@@H](c3ccccn3)C2)cc1 |
| InChI | InChI=1S/C18H18F3N3O2S/c19-18(20,21)26-14-6-4-12(5-7-14)23-17(27)24-13-8-10-25-16(11-13)15-3-1-2-9-22-15/h1-7,9,13,16H,8,10-11H2,(H2,23,24,27)/t13-,16-/m1/s1 |
| InChIKey | NOUSIWLBRQBKLW-CZUORRHYSA-N |
| XLogP | 4.19 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|