C24H21F3N6O2S — CID 147859552
1-[1-[3-cyano-4-[4-(trifluoromethoxy)phenoxy]-2-pyridinyl]piperidin-4-yl]-3-pyridin-3-ylthiourea (PubChem CID 147859552) has the molecular formula C24H21F3N6O2S and a molecular weight of 514.53 g/mol. Its IUPAC name is 1-[1-[3-cyano-4-[4-(trifluoromethoxy)phenoxy]-2-pyridinyl]piperidin-4-yl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[1-[3-cyano-4-[4-(trifluoromethoxy)phenoxy]-2-pyridinyl]piperidin-4-yl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 147859552 |
| Molecular Formula | C24H21F3N6O2S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 1-[1-[3-cyano-4-[4-(trifluoromethoxy)phenoxy]-2-pyridinyl]piperidin-4-yl]-3-pyridin-3-ylthiourea |
| SMILES | N#Cc1c(Oc2ccc(OC(F)(F)F)cc2)ccnc1N1CCC(NC(=S)Nc2cccnc2)CC1 |
| InChI | InChI=1S/C24H21F3N6O2S/c25-24(26,27)35-19-5-3-18(4-6-19)34-21-7-11-30-22(20(21)14-28)33-12-8-16(9-13-33)31-23(36)32-17-2-1-10-29-15-17/h1-7,10-11,15-16H,8-9,12-13H2,(H2,31,32,36) |
| InChIKey | HWKGFFLRZLZLPX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|