C16H18FN5S — CID 146928698
1-[1-(5-fluoro-2-pyridinyl)piperidin-4-yl]-3-pyridin-3-ylthiourea (PubChem CID 146928698) has the molecular formula C16H18FN5S and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[1-(5-fluoro-2-pyridinyl)piperidin-4-yl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[1-(5-fluoro-2-pyridinyl)piperidin-4-yl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 146928698 |
| Molecular Formula | C16H18FN5S |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-[1-(5-fluoro-2-pyridinyl)piperidin-4-yl]-3-pyridin-3-ylthiourea |
| SMILES | Fc1ccc(N2CCC(NC(=S)Nc3cccnc3)CC2)nc1 |
| InChI | InChI=1S/C16H18FN5S/c17-12-3-4-15(19-10-12)22-8-5-13(6-9-22)20-16(23)21-14-2-1-7-18-11-14/h1-4,7,10-11,13H,5-6,8-9H2,(H2,20,21,23) |
| InChIKey | AEOLONWQRYWMJE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|