C20H24F3N5OS — CID 148877476
1-pyridin-3-yl-3-[1-[4-(4,4,4-trifluorobutoxy)-2-pyridinyl]piperidin-4-yl]thiourea (PubChem CID 148877476) has the molecular formula C20H24F3N5OS and a molecular weight of 439.51 g/mol. Its IUPAC name is 1-pyridin-3-yl-3-[1-[4-(4,4,4-trifluorobutoxy)-2-pyridinyl]piperidin-4-yl]thiourea.
| Compound Name | 1-pyridin-3-yl-3-[1-[4-(4,4,4-trifluorobutoxy)-2-pyridinyl]piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 148877476 |
| Molecular Formula | C20H24F3N5OS |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-pyridin-3-yl-3-[1-[4-(4,4,4-trifluorobutoxy)-2-pyridinyl]piperidin-4-yl]thiourea |
| SMILES | FC(F)(F)CCCOc1ccnc(N2CCC(NC(=S)Nc3cccnc3)CC2)c1 |
| InChI | InChI=1S/C20H24F3N5OS/c21-20(22,23)7-2-12-29-17-4-9-25-18(13-17)28-10-5-15(6-11-28)26-19(30)27-16-3-1-8-24-14-16/h1,3-4,8-9,13-15H,2,5-7,10-12H2,(H2,26,27,30) |
| InChIKey | PCJWAMDRJWDUMO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|