C11H14F3N3O — CID 175146023
1-[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]pyrrolidin-3-amine (PubChem CID 175146023) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 1-[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]pyrrolidin-3-amine.
| Compound Name | 1-[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 175146023 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]pyrrolidin-3-amine |
| SMILES | NC1CCN(c2cc(OCC(F)(F)F)ccn2)C1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)7-18-9-1-3-16-10(5-9)17-4-2-8(15)6-17/h1,3,5,8H,2,4,6-7,15H2 |
| InChIKey | VYLLBVARMKPLRS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |