C12H19FN4O2S — CID 146094303
3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-sulfonyl fluoride (PubChem CID 146094303) has the molecular formula C12H19FN4O2S and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-sulfonyl fluoride.
| Compound Name | 3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 146094303 |
| Molecular Formula | C12H19FN4O2S |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidine-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)N1CCCC(c2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C12H19FN4O2S/c13-20(18,19)16-7-4-5-10(9-16)12-15-14-11-6-2-1-3-8-17(11)12/h10H,1-9H2 |
| InChIKey | BSZLJRNKGYIWGB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |