C22H31N5O3S2 — CID 42024911
[(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone (PubChem CID 42024911) has the molecular formula C22H31N5O3S2 and a molecular weight of 477.66 g/mol. Its IUPAC name is [(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 42024911 |
| Molecular Formula | C22H31N5O3S2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [(3S)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cccs2)CC1)N1CCC[C@H](c2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C22H31N5O3S2/c28-22(17-9-13-26(14-10-17)32(29,30)20-8-5-15-31-20)25-11-4-6-18(16-25)21-24-23-19-7-2-1-3-12-27(19)21/h5,8,15,17-18H,1-4,6-7,9-14,16H2/t18-/m0/s1 |
| InChIKey | RBPQFBNMRSDZEL-SFHVURJKSA-N |
| XLogP | 2.87 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |