C8H10FN3O2S — CID 146094317
N-methyl-N-[(1-prop-2-ynylpyrazol-4-yl)methyl]sulfamoyl fluoride (PubChem CID 146094317) has the molecular formula C8H10FN3O2S and a molecular weight of 231.25 g/mol. Its IUPAC name is N-methyl-N-[(1-prop-2-ynylpyrazol-4-yl)methyl]sulfamoyl fluoride.
| Compound Name | N-methyl-N-[(1-prop-2-ynylpyrazol-4-yl)methyl]sulfamoyl fluoride |
|---|---|
| PubChem CID | 146094317 |
| Molecular Formula | C8H10FN3O2S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-methyl-N-[(1-prop-2-ynylpyrazol-4-yl)methyl]sulfamoyl fluoride |
| SMILES | C#CCn1cc(CN(C)S(=O)(=O)F)cn1 |
| InChI | InChI=1S/C8H10FN3O2S/c1-3-4-12-7-8(5-10-12)6-11(2)15(9,13)14/h1,5,7H,4,6H2,2H3 |
| InChIKey | VLKMTCRJBUNAJN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|