C13H15ClN2O5S — CID 146094613
2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)azetidin-3-yl]acetamide (PubChem CID 146094613) has the molecular formula C13H15ClN2O5S and a molecular weight of 346.79 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)azetidin-3-yl]acetamide.
| Compound Name | 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)azetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 146094613 |
| Molecular Formula | C13H15ClN2O5S |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)azetidin-3-yl]acetamide |
| SMILES | O=C(CCl)NC1CN(S(=O)(=O)c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C13H15ClN2O5S/c14-6-13(17)15-9-7-16(8-9)22(18,19)10-1-2-11-12(5-10)21-4-3-20-11/h1-2,5,9H,3-4,6-8H2,(H,15,17) |
| InChIKey | QEVHZZOYMPXEOM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|