C11H10ClFN2O2 — CID 146094664
2-chloro-N-(5-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)acetamide (PubChem CID 146094664) has the molecular formula C11H10ClFN2O2 and a molecular weight of 256.66 g/mol. Its IUPAC name is 2-chloro-N-(5-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)acetamide.
| Compound Name | 2-chloro-N-(5-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 146094664 |
| Molecular Formula | C11H10ClFN2O2 |
| Molecular Weight | 256.66 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-chloro-N-(5-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)acetamide |
| SMILES | O=C(CCl)Nc1ccc2c(c1F)CCNC2=O |
| InChI | InChI=1S/C11H10ClFN2O2/c12-5-9(16)15-8-2-1-7-6(10(8)13)3-4-14-11(7)17/h1-2H,3-5H2,(H,14,17)(H,15,16) |
| InChIKey | ARMJTUNRVSOOPD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.66 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|