C16H15FN2O — CID 63901349
4-fluoro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide (PubChem CID 63901349) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is 4-fluoro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide.
| Compound Name | 4-fluoro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 63901349 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-fluoro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CNCC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2O/c17-14-4-1-12(2-5-14)16(20)19-15-6-3-11-7-8-18-10-13(11)9-15/h1-6,9,18H,7-8,10H2,(H,19,20) |
| InChIKey | PGZJYUJKVGSJFI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |