C7H9N3O2S — CID 146097163
cis-(1R,2S)-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)cyclobutane-1-carboxylic acid (PubChem CID 146097163) has the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. Its IUPAC name is cis-(1R,2S)-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)cyclobutane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 146097163 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | cis-(1R,2S)-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@@H]1c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C7H9N3O2S/c11-6(12)4-2-1-3(4)5-8-7(13)10-9-5/h3-4H,1-2H2,(H,11,12)(H2,8,9,10,13)/t3-,4+/m0/s1 |
| InChIKey | RMTDPQSXHITWQN-IUYQGCFVSA-N |
| XLogP | 1.05 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|