C19H33N3O3 — CID 146098113
tert-butyl 3-cyclopropyl-2-[[[(E)-4-(dimethylamino)but-2-enoyl]amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 146098113) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl 3-cyclopropyl-2-[[[(E)-4-(dimethylamino)but-2-enoyl]amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-cyclopropyl-2-[[[(E)-4-(dimethylamino)but-2-enoyl]amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146098113 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | tert-butyl 3-cyclopropyl-2-[[[(E)-4-(dimethylamino)but-2-enoyl]amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C)C/C=C/C(=O)NCC1C(C2CC2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33N3O3/c1-19(2,3)25-18(24)22-12-10-15(14-8-9-14)16(22)13-20-17(23)7-6-11-21(4)5/h6-7,14-16H,8-13H2,1-5H3,(H,20,23)/b7-6+ |
| InChIKey | DVIROZJNMAJZFN-VOTSOKGWSA-N |
| XLogP | 2.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|