C19H23N5O2 — CID 146101193
(5R,7S)-N-(2-cyanoethyl)-1,5,7-trimethyl-N-(pyridin-3-ylmethyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146101193) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is (5R,7S)-N-(2-cyanoethyl)-1,5,7-trimethyl-N-(pyridin-3-ylmethyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-(2-cyanoethyl)-1,5,7-trimethyl-N-(pyridin-3-ylmethyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146101193 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (5R,7S)-N-(2-cyanoethyl)-1,5,7-trimethyl-N-(pyridin-3-ylmethyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)N(CCC#N)Cc3cccnc3)nn(C)c2[C@H](C)O1 |
| InChI | InChI=1S/C19H23N5O2/c1-13-10-16-17(22-23(3)18(16)14(2)26-13)19(25)24(9-5-7-20)12-15-6-4-8-21-11-15/h4,6,8,11,13-14H,5,9-10,12H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | QUGXFLSBESJDOS-KGLIPLIRSA-N |
| XLogP | 2.39 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |