About 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide
3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide (PubChem CID 146102608) has the molecular formula C18H16ClN3O3
and a molecular weight of 357.80 g/mol. Its IUPAC name is 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide.
Molecular Properties
| Compound Name | 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide |
| PubChem CID | 146102608 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CN2C(=O)CC(c3cccc(Cl)c3)NC2=O)c1 |
| InChI | InChI=1S/C18H16ClN3O3/c19-14-6-2-4-12(8-14)15-9-16(23)22(18(25)21-15)10-11-3-1-5-13(7-11)17(20)24/h1-8,15H,9-10H2,(H2,20,24)(H,21,25) |
| InChIKey | CPFZIOHXBYQOSB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide?
The IUPAC name of 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide (CID 146102608) is 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide.
What is the SMILES notation for 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide?
The canonical SMILES for 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide is NC(=O)c1cccc(CN2C(=O)CC(c3cccc(Cl)c3)NC2=O)c1.
What is the InChIKey of 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide?
The InChIKey is CPFZIOHXBYQOSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN3O3/c19-14-6-2-4-12(8-14)15-9-16(23)22(18(25)21-15)10-11-3-1-5-13(7-11)17(20)24/h1-8,15H,9-10H2,(H2,20,24)(H,21,25).
What are the key properties of 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide?
3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide has a molecular weight of 357.80 g/mol, XLogP of 2.62, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide is sourced from PubChem (CID 146102608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).