C18H16ClN3O3 — CID 146102608
3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide (PubChem CID 146102608) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide.
| Compound Name | 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 146102608 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-[[4-(3-chlorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CN2C(=O)CC(c3cccc(Cl)c3)NC2=O)c1 |
| InChI | InChI=1S/C18H16ClN3O3/c19-14-6-2-4-12(8-14)15-9-16(23)22(18(25)21-15)10-11-3-1-5-13(7-11)17(20)24/h1-8,15H,9-10H2,(H2,20,24)(H,21,25) |
| InChIKey | CPFZIOHXBYQOSB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |