C26H25N3O3 — CID 42851590
3-[(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)methyl]-N-(1-phenylethyl)benzamide (PubChem CID 42851590) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-[(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)methyl]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)methyl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42851590 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-[(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)methyl]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(CN2C(=O)CC(c3ccccc3)NC2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C26H25N3O3/c1-18(20-10-4-2-5-11-20)27-25(31)22-14-8-9-19(15-22)17-29-24(30)16-23(28-26(29)32)21-12-6-3-7-13-21/h2-15,18,23H,16-17H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | VXYAOBQREZNNCP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |