C18H25N3O2 — CID 146103850
5-cycloheptyl-3-(2-pyridin-3-ylethyl)-1,3-diazinane-2,4-dione (PubChem CID 146103850) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 5-cycloheptyl-3-(2-pyridin-3-ylethyl)-1,3-diazinane-2,4-dione.
| Compound Name | 5-cycloheptyl-3-(2-pyridin-3-ylethyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 146103850 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 5-cycloheptyl-3-(2-pyridin-3-ylethyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1NCC(C2CCCCCC2)C(=O)N1CCc1cccnc1 |
| InChI | InChI=1S/C18H25N3O2/c22-17-16(15-7-3-1-2-4-8-15)13-20-18(23)21(17)11-9-14-6-5-10-19-12-14/h5-6,10,12,15-16H,1-4,7-9,11,13H2,(H,20,23) |
| InChIKey | VKHCQACQRJFLMA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |