C10H16ClF3N2O — CID 146105333
2-chloro-N-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]acetamide (PubChem CID 146105333) has the molecular formula C10H16ClF3N2O and a molecular weight of 272.70 g/mol. Its IUPAC name is 2-chloro-N-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]acetamide.
| Compound Name | 2-chloro-N-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 146105333 |
| Molecular Formula | C10H16ClF3N2O |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-chloro-N-ethyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]acetamide |
| SMILES | CCN(C(=O)CCl)C1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C10H16ClF3N2O/c1-2-16(9(17)5-11)8-3-4-15(6-8)7-10(12,13)14/h8H,2-7H2,1H3 |
| InChIKey | VHBHGVRTLANIAS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|