C16H28N2O4 — CID 146106031
tert-butyl 4-(methoxymethyl)-4-[(prop-2-enoylamino)methyl]piperidine-1-carboxylate (PubChem CID 146106031) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl 4-(methoxymethyl)-4-[(prop-2-enoylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(methoxymethyl)-4-[(prop-2-enoylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146106031 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | tert-butyl 4-(methoxymethyl)-4-[(prop-2-enoylamino)methyl]piperidine-1-carboxylate |
| SMILES | C=CC(=O)NCC1(COC)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28N2O4/c1-6-13(19)17-11-16(12-21-5)7-9-18(10-8-16)14(20)22-15(2,3)4/h6H,1,7-12H2,2-5H3,(H,17,19) |
| InChIKey | YXMUTTMBZSKFMZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|