C15H16FN3O4S — CID 146106300
(4-acetamido-2-fluorophenyl) 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonate (PubChem CID 146106300) has the molecular formula C15H16FN3O4S and a molecular weight of 353.38 g/mol. Its IUPAC name is (4-acetamido-2-fluorophenyl) 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonate.
| Compound Name | (4-acetamido-2-fluorophenyl) 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonate |
|---|---|
| PubChem CID | 146106300 |
| Molecular Formula | C15H16FN3O4S |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (4-acetamido-2-fluorophenyl) 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonate |
| SMILES | CC(=O)Nc1ccc(OS(=O)(=O)c2cnc3n2CCCC3)c(F)c1 |
| InChI | InChI=1S/C15H16FN3O4S/c1-10(20)18-11-5-6-13(12(16)8-11)23-24(21,22)15-9-17-14-4-2-3-7-19(14)15/h5-6,8-9H,2-4,7H2,1H3,(H,18,20) |
| InChIKey | LDKXQBADUAWOIF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|