C12H19N7O — CID 146107580
2-tert-butyl-N-methyl-N-(2-pyrazol-1-ylethyl)tetrazole-5-carboxamide (PubChem CID 146107580) has the molecular formula C12H19N7O and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-tert-butyl-N-methyl-N-(2-pyrazol-1-ylethyl)tetrazole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-methyl-N-(2-pyrazol-1-ylethyl)tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 146107580 |
| Molecular Formula | C12H19N7O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-tert-butyl-N-methyl-N-(2-pyrazol-1-ylethyl)tetrazole-5-carboxamide |
| SMILES | CN(CCn1cccn1)C(=O)c1nnn(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H19N7O/c1-12(2,3)19-15-10(14-16-19)11(20)17(4)8-9-18-7-5-6-13-18/h5-7H,8-9H2,1-4H3 |
| InChIKey | OXKHNLMFKLTESK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |