C18H19F4NO4 — CID 146107768
tert-butyl (3aR,6aR)-5-(2,3,5,6-tetrafluorobenzoyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate (PubChem CID 146107768) has the molecular formula C18H19F4NO4 and a molecular weight of 389.35 g/mol. Its IUPAC name is tert-butyl (3aR,6aR)-5-(2,3,5,6-tetrafluorobenzoyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate.
| Compound Name | tert-butyl (3aR,6aR)-5-(2,3,5,6-tetrafluorobenzoyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 146107768 |
| Molecular Formula | C18H19F4NO4 |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | tert-butyl (3aR,6aR)-5-(2,3,5,6-tetrafluorobenzoyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]12COC[C@H]1CN(C(=O)c1c(F)c(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C18H19F4NO4/c1-17(2,3)27-16(25)18-7-23(5-9(18)6-26-8-18)15(24)12-13(21)10(19)4-11(20)14(12)22/h4,9H,5-8H2,1-3H3/t9-,18-/m1/s1 |
| InChIKey | NYNCHUFDTLDLEU-DYBLOJMWSA-N |
| XLogP | 2.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|