C22H20Cl2N2 — CID 146109991
1-[(4-chlorophenyl)methyl]-3-[(4-methylphenyl)methyl]benzimidazol-1-ium chloride (PubChem CID 146109991) has the molecular formula C22H20Cl2N2 and a molecular weight of 383.32 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[(4-methylphenyl)methyl]benzimidazol-1-ium chloride.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[(4-methylphenyl)methyl]benzimidazol-1-ium chloride |
|---|---|
| PubChem CID | 146109991 |
| Molecular Formula | C22H20Cl2N2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[(4-methylphenyl)methyl]benzimidazol-1-ium chloride |
| SMILES | Cc1ccc(Cn2c[n+](Cc3ccc(Cl)cc3)c3ccccc32)cc1.[Cl-] |
| InChI | InChI=1S/C22H20ClN2.ClH/c1-17-6-8-18(9-7-17)14-24-16-25(22-5-3-2-4-21(22)24)15-19-10-12-20(23)13-11-19;/h2-13,16H,14-15H2,1H3;1H/q+1;/p-1 |
| InChIKey | ZTJRGPTZGBSUHO-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|