C31H27Cl2N2+ — CID 102529050
4,5-bis(4-chlorophenyl)-1,3-bis[(4-methylphenyl)methyl]imidazol-1-ium (PubChem CID 102529050) has the molecular formula C31H27Cl2N2+ and a molecular weight of 498.48 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-1,3-bis[(4-methylphenyl)methyl]imidazol-1-ium.
| Compound Name | 4,5-bis(4-chlorophenyl)-1,3-bis[(4-methylphenyl)methyl]imidazol-1-ium |
|---|---|
| PubChem CID | 102529050 |
| Molecular Formula | C31H27Cl2N2+ |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-1,3-bis[(4-methylphenyl)methyl]imidazol-1-ium |
| SMILES | Cc1ccc(Cn2c[n+](Cc3ccc(C)cc3)c(-c3ccc(Cl)cc3)c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H27Cl2N2/c1-22-3-7-24(8-4-22)19-34-21-35(20-25-9-5-23(2)6-10-25)31(27-13-17-29(33)18-14-27)30(34)26-11-15-28(32)16-12-26/h3-18,21H,19-20H2,1-2H3/q+1 |
| InChIKey | NMDPQHSUHQBTJY-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|