C24H21F2N2+ — CID 166514496
1-benzyl-3-ethyl-4,5-bis(4-fluorophenyl)imidazol-1-ium (PubChem CID 166514496) has the molecular formula C24H21F2N2+ and a molecular weight of 375.44 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-4,5-bis(4-fluorophenyl)imidazol-1-ium.
| Compound Name | 1-benzyl-3-ethyl-4,5-bis(4-fluorophenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 166514496 |
| Molecular Formula | C24H21F2N2+ |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-benzyl-3-ethyl-4,5-bis(4-fluorophenyl)imidazol-1-ium |
| SMILES | CCn1c[n+](Cc2ccccc2)c(-c2ccc(F)cc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21F2N2/c1-2-27-17-28(16-18-6-4-3-5-7-18)24(20-10-14-22(26)15-11-20)23(27)19-8-12-21(25)13-9-19/h3-15,17H,2,16H2,1H3/q+1 |
| InChIKey | GXSXCQUICYSFMT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|