C29H23N4+ — CID 163592721
2-(3-benzyl-4,5-diphenylimidazol-3-ium-1-yl)-1H-benzimidazole (PubChem CID 163592721) has the molecular formula C29H23N4+ and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-(3-benzyl-4,5-diphenylimidazol-3-ium-1-yl)-1H-benzimidazole.
| Compound Name | 2-(3-benzyl-4,5-diphenylimidazol-3-ium-1-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 163592721 |
| Molecular Formula | C29H23N4+ |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-(3-benzyl-4,5-diphenylimidazol-3-ium-1-yl)-1H-benzimidazole |
| SMILES | c1ccc(C[n+]2cn(-c3nc4ccccc4[nH]3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23N4/c1-4-12-22(13-5-1)20-32-21-33(29-30-25-18-10-11-19-26(25)31-29)28(24-16-8-3-9-17-24)27(32)23-14-6-2-7-15-23/h1-19,21H,20H2,(H,30,31)/q+1 |
| InChIKey | GQVKGVHTOCKJFZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|