C23H22N3O2+ — CID 45051086
1-benzyl-5,6-dimethyl-3-[(4-nitrophenyl)methyl]benzimidazol-1-ium (PubChem CID 45051086) has the molecular formula C23H22N3O2+ and a molecular weight of 372.45 g/mol. Its IUPAC name is 1-benzyl-5,6-dimethyl-3-[(4-nitrophenyl)methyl]benzimidazol-1-ium.
| Compound Name | 1-benzyl-5,6-dimethyl-3-[(4-nitrophenyl)methyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 45051086 |
| Molecular Formula | C23H22N3O2+ |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-benzyl-5,6-dimethyl-3-[(4-nitrophenyl)methyl]benzimidazol-1-ium |
| SMILES | Cc1cc2c(cc1C)[n+](Cc1ccccc1)cn2Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22N3O2/c1-17-12-22-23(13-18(17)2)25(15-20-8-10-21(11-9-20)26(27)28)16-24(22)14-19-6-4-3-5-7-19/h3-13,16H,14-15H2,1-2H3/q+1 |
| InChIKey | RFTVLUVLPIIVRJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|