C24H22N3O3+ — CID 3420055
2-(3-benzyl-5,6-dimethylbenzimidazol-3-ium-1-yl)-1-(4-nitrophenyl)ethanone (PubChem CID 3420055) has the molecular formula C24H22N3O3+ and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-(3-benzyl-5,6-dimethylbenzimidazol-3-ium-1-yl)-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-(3-benzyl-5,6-dimethylbenzimidazol-3-ium-1-yl)-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 3420055 |
| Molecular Formula | C24H22N3O3+ |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-(3-benzyl-5,6-dimethylbenzimidazol-3-ium-1-yl)-1-(4-nitrophenyl)ethanone |
| SMILES | Cc1cc2c(cc1C)[n+](Cc1ccccc1)cn2CC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H22N3O3/c1-17-12-22-23(13-18(17)2)26(16-25(22)14-19-6-4-3-5-7-19)15-24(28)20-8-10-21(11-9-20)27(29)30/h3-13,16H,14-15H2,1-2H3/q+1 |
| InChIKey | KTSSZLFGGIGVTR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|