C23H22N2 — CID 139043177
1,3-dibenzyl-5,6-dimethyl-2H-benzimidazol-3-ium-2-ide (PubChem CID 139043177) has the molecular formula C23H22N2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1,3-dibenzyl-5,6-dimethyl-2H-benzimidazol-3-ium-2-ide.
| Compound Name | 1,3-dibenzyl-5,6-dimethyl-2H-benzimidazol-3-ium-2-ide |
|---|---|
| PubChem CID | 139043177 |
| Molecular Formula | C23H22N2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1,3-dibenzyl-5,6-dimethyl-2H-benzimidazol-3-ium-2-ide |
| SMILES | Cc1cc2c(cc1C)[n+](Cc1ccccc1)[c-]n2Cc1ccccc1 |
| InChI | InChI=1S/C23H22N2/c1-18-13-22-23(14-19(18)2)25(16-21-11-7-4-8-12-21)17-24(22)15-20-9-5-3-6-10-20/h3-14H,15-16H2,1-2H3 |
| InChIKey | POVNWRFIBFKURT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|