C17H25N5O — CID 146111644
(3R,5R)-5-(aminomethyl)-1-[6-(5-azaspiro[2.6]non-7-en-5-yl)pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 146111644) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is (3R,5R)-5-(aminomethyl)-1-[6-(5-azaspiro[2.6]non-7-en-5-yl)pyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | (3R,5R)-5-(aminomethyl)-1-[6-(5-azaspiro[2.6]non-7-en-5-yl)pyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 146111644 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | (3R,5R)-5-(aminomethyl)-1-[6-(5-azaspiro[2.6]non-7-en-5-yl)pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | NC[C@H]1C[C@@H](O)CN1c1cc(N2CC=CCC3(CC3)C2)ncn1 |
| InChI | InChI=1S/C17H25N5O/c18-9-13-7-14(23)10-22(13)16-8-15(19-12-20-16)21-6-2-1-3-17(11-21)4-5-17/h1-2,8,12-14,23H,3-7,9-11,18H2/t13-,14-/m1/s1 |
| InChIKey | MJIGBNNPLVWGPZ-ZIAGYGMSSA-N |
| XLogP | 0.92 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|