C19H24N6O2 — CID 146113637
(5R,7S)-1-ethyl-N,5,7-trimethyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146113637) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (5R,7S)-1-ethyl-N,5,7-trimethyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-1-ethyl-N,5,7-trimethyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146113637 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (5R,7S)-1-ethyl-N,5,7-trimethyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | CCn1nc(C(=O)N(C)Cc2nnc3ccccn23)c2c1[C@H](C)O[C@H](C)C2 |
| InChI | InChI=1S/C19H24N6O2/c1-5-25-18-13(3)27-12(2)10-14(18)17(22-25)19(26)23(4)11-16-21-20-15-8-6-7-9-24(15)16/h6-9,12-13H,5,10-11H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | LKSIVCYQXGOULV-OLZOCXBDSA-N |
| XLogP | 2.24 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |