C17H26N4O4 — CID 146115446
4-[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-1-(2-methoxyethyl)-1,4-diazepan-2-one (PubChem CID 146115446) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-1-(2-methoxyethyl)-1,4-diazepan-2-one.
| Compound Name | 4-[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-1-(2-methoxyethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 146115446 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carbonyl]-1-(2-methoxyethyl)-1,4-diazepan-2-one |
| SMILES | COCCN1CCCN(C(=O)c2n[nH]c3c2C[C@H](C)O[C@@H]3C)CC1=O |
| InChI | InChI=1S/C17H26N4O4/c1-11-9-13-15(12(2)25-11)18-19-16(13)17(23)21-6-4-5-20(7-8-24-3)14(22)10-21/h11-12H,4-10H2,1-3H3,(H,18,19)/t11-,12+/m0/s1 |
| InChIKey | ARJXNDGBNLESQF-NWDGAFQWSA-N |
| XLogP | 0.75 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |