C17H21NO4S — CID 14611677
[1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,7a-hexahydroindol-5-yl] acetate (PubChem CID 14611677) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,7a-hexahydroindol-5-yl] acetate.
| Compound Name | [1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,7a-hexahydroindol-5-yl] acetate |
|---|---|
| PubChem CID | 14611677 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | [1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,7a-hexahydroindol-5-yl] acetate |
| SMILES | CC(=O)OC1C=CC2C(CCN2S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C17H21NO4S/c1-12-3-6-16(7-4-12)23(20,21)18-10-9-14-11-15(22-13(2)19)5-8-17(14)18/h3-8,14-15,17H,9-11H2,1-2H3 |
| InChIKey | LFHMWHRHUVLWHK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|