C27H37F3N4O5 — CID 146117007
(4S)-12-(cyclohexylmethyl)-6-(2-methoxyacetyl)-19-(trifluoromethyl)-2-oxa-6,9,12,15-tetrazatricyclo[15.4.0.04,9]henicosa-1(17),18,20-triene-10,16-dione (PubChem CID 146117007) has the molecular formula C27H37F3N4O5 and a molecular weight of 554.61 g/mol. Its IUPAC name is (4S)-12-(cyclohexylmethyl)-6-(2-methoxyacetyl)-19-(trifluoromethyl)-2-oxa-6,9,12,15-tetrazatricyclo[15.4.0.04,9]henicosa-1(17),18,20-triene-10,16-dione.
| Compound Name | (4S)-12-(cyclohexylmethyl)-6-(2-methoxyacetyl)-19-(trifluoromethyl)-2-oxa-6,9,12,15-tetrazatricyclo[15.4.0.04,9]henicosa-1(17),18,20-triene-10,16-dione |
|---|---|
| PubChem CID | 146117007 |
| Molecular Formula | C27H37F3N4O5 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | (4S)-12-(cyclohexylmethyl)-6-(2-methoxyacetyl)-19-(trifluoromethyl)-2-oxa-6,9,12,15-tetrazatricyclo[15.4.0.04,9]henicosa-1(17),18,20-triene-10,16-dione |
| SMILES | COCC(=O)N1CCN2C(=O)CN(CC3CCCCC3)CCNC(=O)c3cc(C(F)(F)F)ccc3OC[C@@H]2C1 |
| InChI | InChI=1S/C27H37F3N4O5/c1-38-18-25(36)33-11-12-34-21(15-33)17-39-23-8-7-20(27(28,29)30)13-22(23)26(37)31-9-10-32(16-24(34)35)14-19-5-3-2-4-6-19/h7-8,13,19,21H,2-6,9-12,14-18H2,1H3,(H,31,37)/t21-/m0/s1 |
| InChIKey | XNZMUMOIJSSZHY-NRFANRHFSA-N |
| XLogP | 2.40 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |