C19H25N3O4 — CID 146119881
(3S,3aS,6aS)-3-(cyclopropylmethoxy)-N-(2-methoxyphenyl)-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide (PubChem CID 146119881) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-(cyclopropylmethoxy)-N-(2-methoxyphenyl)-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide.
| Compound Name | (3S,3aS,6aS)-3-(cyclopropylmethoxy)-N-(2-methoxyphenyl)-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146119881 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3S,3aS,6aS)-3-(cyclopropylmethoxy)-N-(2-methoxyphenyl)-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1C[C@@H]2[C@H](OCC3CC3)C(=O)N(C)[C@@H]2C1 |
| InChI | InChI=1S/C19H25N3O4/c1-21-15-10-22(19(24)20-14-5-3-4-6-16(14)25-2)9-13(15)17(18(21)23)26-11-12-7-8-12/h3-6,12-13,15,17H,7-11H2,1-2H3,(H,20,24)/t13-,15+,17-/m0/s1 |
| InChIKey | QUFBPJZKKIRNMY-LXZKKBNFSA-N |
| XLogP | 1.79 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |