C19H20ClN5O3 — CID 146119957
(3S,3aS,6aS)-N-(2-chlorophenyl)-1-methyl-3-(2-methylpyrimidin-4-yl)oxy-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide (PubChem CID 146119957) has the molecular formula C19H20ClN5O3 and a molecular weight of 401.85 g/mol. Its IUPAC name is (3S,3aS,6aS)-N-(2-chlorophenyl)-1-methyl-3-(2-methylpyrimidin-4-yl)oxy-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide.
| Compound Name | (3S,3aS,6aS)-N-(2-chlorophenyl)-1-methyl-3-(2-methylpyrimidin-4-yl)oxy-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146119957 |
| Molecular Formula | C19H20ClN5O3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (3S,3aS,6aS)-N-(2-chlorophenyl)-1-methyl-3-(2-methylpyrimidin-4-yl)oxy-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
| SMILES | Cc1nccc(O[C@@H]2C(=O)N(C)[C@@H]3CN(C(=O)Nc4ccccc4Cl)C[C@H]23)n1 |
| InChI | InChI=1S/C19H20ClN5O3/c1-11-21-8-7-16(22-11)28-17-12-9-25(10-15(12)24(2)18(17)26)19(27)23-14-6-4-3-5-13(14)20/h3-8,12,15,17H,9-10H2,1-2H3,(H,23,27)/t12-,15+,17-/m0/s1 |
| InChIKey | CZHVIOFGTLRUBG-MJEQTWJJSA-N |
| XLogP | 2.19 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |