C24H23ClN4O3 — CID 146120498
(3S,3aS,9bR)-N-(2-chlorophenyl)-3-[(2-methylpyrimidin-4-yl)oxymethyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide (PubChem CID 146120498) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is (3S,3aS,9bR)-N-(2-chlorophenyl)-3-[(2-methylpyrimidin-4-yl)oxymethyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide.
| Compound Name | (3S,3aS,9bR)-N-(2-chlorophenyl)-3-[(2-methylpyrimidin-4-yl)oxymethyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 146120498 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (3S,3aS,9bR)-N-(2-chlorophenyl)-3-[(2-methylpyrimidin-4-yl)oxymethyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
| SMILES | Cc1nccc(OC[C@@H]2CN(C(=O)Nc3ccccc3Cl)[C@H]3c4ccccc4OC[C@@H]23)n1 |
| InChI | InChI=1S/C24H23ClN4O3/c1-15-26-11-10-22(27-15)32-13-16-12-29(24(30)28-20-8-4-3-7-19(20)25)23-17-6-2-5-9-21(17)31-14-18(16)23/h2-11,16,18,23H,12-14H2,1H3,(H,28,30)/t16-,18-,23-/m0/s1 |
| InChIKey | UGQWVZJETVVPKE-CEXJFXJFSA-N |
| XLogP | 4.73 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |