C24H29ClN2O3 — CID 146120482
(3S,3aS,9bR)-N-(4-chloro-3-methylphenyl)-3-(2-methylpropoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide (PubChem CID 146120482) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is (3S,3aS,9bR)-N-(4-chloro-3-methylphenyl)-3-(2-methylpropoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide.
| Compound Name | (3S,3aS,9bR)-N-(4-chloro-3-methylphenyl)-3-(2-methylpropoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 146120482 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (3S,3aS,9bR)-N-(4-chloro-3-methylphenyl)-3-(2-methylpropoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
| SMILES | Cc1cc(NC(=O)N2C[C@@H](COCC(C)C)[C@@H]3COc4ccccc4[C@@H]32)ccc1Cl |
| InChI | InChI=1S/C24H29ClN2O3/c1-15(2)12-29-13-17-11-27(24(28)26-18-8-9-21(25)16(3)10-18)23-19-6-4-5-7-22(19)30-14-20(17)23/h4-10,15,17,20,23H,11-14H2,1-3H3,(H,26,28)/t17-,20-,23-/m0/s1 |
| InChIKey | CPTIYRWAGHOLLA-NYDSKATKSA-N |
| XLogP | 5.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |